C32H70P2Pd — CID 87443818
bis((3,4-ditert-butyl-5,5-dimethylhexan-4-yl)phosphane);palladium (PubChem CID 87443818) has the molecular formula C32H70P2Pd and a molecular weight of 623.28 g/mol. Its IUPAC name is bis((3,4-ditert-butyl-5,5-dimethylhexan-4-yl)phosphane);palladium.
| Compound Name | bis((3,4-ditert-butyl-5,5-dimethylhexan-4-yl)phosphane);palladium |
|---|---|
| PubChem CID | 87443818 |
| Molecular Formula | C32H70P2Pd |
| Molecular Weight | 623.28 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | bis((3,4-ditert-butyl-5,5-dimethylhexan-4-yl)phosphane);palladium |
| SMILES | CCC(C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C.CCC(C(C)(C)C)C(P)(C(C)(C)C)C(C)(C)C.[Pd] |
| InChI | InChI=1S/2C16H35P.Pd/c2*1-11-12(13(2,3)4)16(17,14(5,6)7)15(8,9)10;/h2*12H,11,17H2,1-10H3; |
| InChIKey | PRACTRRGGKFUCB-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.28 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|