C5H6Br6 — CID 54380667
1,1,1-tribromo-2-(tribromomethyl)butane (PubChem CID 54380667) has the molecular formula C5H6Br6 and a molecular weight of 545.53 g/mol. Its IUPAC name is 1,1,1-tribromo-2-(tribromomethyl)butane.
| Compound Name | 1,1,1-tribromo-2-(tribromomethyl)butane |
|---|---|
| PubChem CID | 54380667 |
| Molecular Formula | C5H6Br6 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 539.56 |
| IUPAC Name | 1,1,1-tribromo-2-(tribromomethyl)butane |
| SMILES | CCC(C(Br)(Br)Br)C(Br)(Br)Br |
| InChI | InChI=1S/C5H6Br6/c1-2-3(4(6,7)8)5(9,10)11/h3H,2H2,1H3 |
| InChIKey | WFJZJCBGGIWXAY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|