C6H12Br2 — CID 98087028
(3S,4S)-3,4-dibromohexane (PubChem CID 98087028) has the molecular formula C6H12Br2 and a molecular weight of 243.97 g/mol. Its IUPAC name is (3S,4S)-3,4-dibromohexane.
| Compound Name | (3S,4S)-3,4-dibromohexane |
|---|---|
| PubChem CID | 98087028 |
| Molecular Formula | C6H12Br2 |
| Molecular Weight | 243.97 g/mol |
| Exact Mass | 241.93 |
| IUPAC Name | (3S,4S)-3,4-dibromohexane |
| SMILES | CC[C@H](Br)[C@@H](Br)CC |
| InChI | InChI=1S/C6H12Br2/c1-3-5(7)6(8)4-2/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | VCQBYNRFLHNSKA-WDSKDSINSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.97 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|