C31H26O7 — CID 87445570
(1E,6E)-1-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)methoxy]phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 87445570) has the molecular formula C31H26O7 and a molecular weight of 510.54 g/mol. Its IUPAC name is (1E,6E)-1-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)methoxy]phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)methoxy]phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 87445570 |
| Molecular Formula | C31H26O7 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (1E,6E)-1-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)methoxy]phenyl]-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OCc3c(O)ccc4ccccc34)c2)ccc1O |
| InChI | InChI=1S/C31H26O7/c1-37-30-16-20(8-13-28(30)35)6-11-23(32)18-24(33)12-7-21-9-14-29(36)31(17-21)38-19-26-25-5-3-2-4-22(25)10-15-27(26)34/h2-17,34-36H,18-19H2,1H3/b11-6+,12-7+ |
| InChIKey | IEWCUUANJNINSV-GNXRPPCSSA-N |
| XLogP | 5.80 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|