C16H19N3O5 — CID 87449994
[3-(hydroxyamino)-3-oxo-2-[(4-pent-1-ynylbenzoyl)amino]propyl]carbamic acid (PubChem CID 87449994) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is [3-(hydroxyamino)-3-oxo-2-[(4-pent-1-ynylbenzoyl)amino]propyl]carbamic acid.
| Compound Name | [3-(hydroxyamino)-3-oxo-2-[(4-pent-1-ynylbenzoyl)amino]propyl]carbamic acid |
|---|---|
| PubChem CID | 87449994 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [3-(hydroxyamino)-3-oxo-2-[(4-pent-1-ynylbenzoyl)amino]propyl]carbamic acid |
| SMILES | CCCC#Cc1ccc(C(=O)NC(CNC(=O)O)C(=O)NO)cc1 |
| InChI | InChI=1S/C16H19N3O5/c1-2-3-4-5-11-6-8-12(9-7-11)14(20)18-13(15(21)19-24)10-17-16(22)23/h6-9,13,17,24H,2-3,10H2,1H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | DEAJRZPVBIAYFE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|