C20H27IN2O7S — CID 145425302
ethene;N-[1-(3-ethoxy-1,1-dioxothietan-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;hydroiodide (PubChem CID 145425302) has the molecular formula C20H27IN2O7S and a molecular weight of 566.41 g/mol. Its IUPAC name is ethene;N-[1-(3-ethoxy-1,1-dioxothietan-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;hydroiodide.
| Compound Name | ethene;N-[1-(3-ethoxy-1,1-dioxothietan-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 145425302 |
| Molecular Formula | C20H27IN2O7S |
| Molecular Weight | 566.41 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | ethene;N-[1-(3-ethoxy-1,1-dioxothietan-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;hydroiodide |
| SMILES | C=C.CCOC1(C(NC(=O)c2ccc(C#CCCO)cc2)C(=O)NO)CS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H22N2O7S.C2H4.HI/c1-2-27-18(11-28(25,26)12-18)15(17(23)20-24)19-16(22)14-8-6-13(7-9-14)5-3-4-10-21;1-2;/h6-9,15,21,24H,2,4,10-12H2,1H3,(H,19,22)(H,20,23);1-2H2;1H |
| InChIKey | IXCYOZWCHVHAJY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|