C18H19BN2O4 — CID 145425345
methyl 2-(1-cyano-3-ethoxyboretan-3-yl)-2-[(4-ethynylbenzoyl)amino]acetate (PubChem CID 145425345) has the molecular formula C18H19BN2O4 and a molecular weight of 338.17 g/mol. Its IUPAC name is methyl 2-(1-cyano-3-ethoxyboretan-3-yl)-2-[(4-ethynylbenzoyl)amino]acetate.
| Compound Name | methyl 2-(1-cyano-3-ethoxyboretan-3-yl)-2-[(4-ethynylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 145425345 |
| Molecular Formula | C18H19BN2O4 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | methyl 2-(1-cyano-3-ethoxyboretan-3-yl)-2-[(4-ethynylbenzoyl)amino]acetate |
| SMILES | C#Cc1ccc(C(=O)NC(C(=O)OC)C2(OCC)CB(C#N)C2)cc1 |
| InChI | InChI=1S/C18H19BN2O4/c1-4-13-6-8-14(9-7-13)16(22)21-15(17(23)24-3)18(25-5-2)10-19(11-18)12-20/h1,6-9,15H,5,10-11H2,2-3H3,(H,21,22) |
| InChIKey | YCZIDIDKCNHOFD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|