C19H26IN3O7S — CID 145425362
CID 145425362 (PubChem CID 145425362) has the molecular formula C19H26IN3O7S and a molecular weight of 567.40 g/mol.
| Compound Name | CID 145425362 |
|---|---|
| PubChem CID | 145425362 |
| Molecular Formula | C19H26IN3O7S |
| Molecular Weight | 567.40 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | — |
| SMILES | C=C.COC1(C(NC(=O)c2ccc(C#CCCO)cc2)C(=O)NO)CS(=O)(=O)C1.NI |
| InChI | InChI=1S/C17H20N2O7S.C2H4.H2IN/c1-26-17(10-27(24,25)11-17)14(16(22)19-23)18-15(21)13-7-5-12(6-8-13)4-2-3-9-20;2*1-2/h5-8,14,20,23H,3,9-11H2,1H3,(H,18,21)(H,19,22);1-2H2;2H2 |
| InChIKey | ODZHIDOHUABORX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|