C21H27N3O6 — CID 145425431
N-[1-(1-acetyl-3-methoxyazetidin-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;ethene (PubChem CID 145425431) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is N-[1-(1-acetyl-3-methoxyazetidin-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;ethene.
| Compound Name | N-[1-(1-acetyl-3-methoxyazetidin-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;ethene |
|---|---|
| PubChem CID | 145425431 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[1-(1-acetyl-3-methoxyazetidin-3-yl)-2-(hydroxyamino)-2-oxoethyl]-4-(4-hydroxybut-1-ynyl)benzamide;ethene |
| SMILES | C=C.COC1(C(NC(=O)c2ccc(C#CCCO)cc2)C(=O)NO)CN(C(C)=O)C1 |
| InChI | InChI=1S/C19H23N3O6.C2H4/c1-13(24)22-11-19(12-22,28-2)16(18(26)21-27)20-17(25)15-8-6-14(7-9-15)5-3-4-10-23;1-2/h6-9,16,23,27H,4,10-12H2,1-2H3,(H,20,25)(H,21,26);1-2H2 |
| InChIKey | MBVMXRHWRYGNJK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|