C14H16O3 — CID 87453615
3-(1,3-dioxol-4-yl)-2-methyl-4-phenylbutanal (PubChem CID 87453615) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(1,3-dioxol-4-yl)-2-methyl-4-phenylbutanal.
| Compound Name | 3-(1,3-dioxol-4-yl)-2-methyl-4-phenylbutanal |
|---|---|
| PubChem CID | 87453615 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-(1,3-dioxol-4-yl)-2-methyl-4-phenylbutanal |
| SMILES | CC(C=O)C(Cc1ccccc1)C1=COCO1 |
| InChI | InChI=1S/C14H16O3/c1-11(8-15)13(14-9-16-10-17-14)7-12-5-3-2-4-6-12/h2-6,8-9,11,13H,7,10H2,1H3 |
| InChIKey | GMNPRYXDOPFPIR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|