C20H18O7 — CID 67425962
methyl 4-[5-[1-(1,3-dioxol-4-yl)-2-phenylethyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 67425962) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl 4-[5-[1-(1,3-dioxol-4-yl)-2-phenylethyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | methyl 4-[5-[1-(1,3-dioxol-4-yl)-2-phenylethyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 67425962 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl 4-[5-[1-(1,3-dioxol-4-yl)-2-phenylethyl]furan-2-yl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | COC(=O)C(=O)C=C(O)c1ccc(C(Cc2ccccc2)C2=COCO2)o1 |
| InChI | InChI=1S/C20H18O7/c1-24-20(23)16(22)10-15(21)18-8-7-17(27-18)14(19-11-25-12-26-19)9-13-5-3-2-4-6-13/h2-8,10-11,14,21H,9,12H2,1H3 |
| InChIKey | KXCPSXVSSRNAJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|