C20H22ClN3O3S — CID 87454492
N-[(2-pentan-2-yloxyphenyl)carbamothioyl]furo[3,2-c]pyridine-2-carboxamide;hydrochloride (PubChem CID 87454492) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is N-[(2-pentan-2-yloxyphenyl)carbamothioyl]furo[3,2-c]pyridine-2-carboxamide;hydrochloride.
| Compound Name | N-[(2-pentan-2-yloxyphenyl)carbamothioyl]furo[3,2-c]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 87454492 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[(2-pentan-2-yloxyphenyl)carbamothioyl]furo[3,2-c]pyridine-2-carboxamide;hydrochloride |
| SMILES | CCCC(C)Oc1ccccc1NC(=S)NC(=O)c1cc2cnccc2o1.Cl |
| InChI | InChI=1S/C20H21N3O3S.ClH/c1-3-6-13(2)25-17-8-5-4-7-15(17)22-20(27)23-19(24)18-11-14-12-21-10-9-16(14)26-18;/h4-5,7-13H,3,6H2,1-2H3,(H2,22,23,24,27);1H |
| InChIKey | JKMAPGGFQCOCFC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|