C22H15F2N3O3S — CID 11259213
N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]carbamothioyl]furo[3,2-c]pyridine-2-carboxamide (PubChem CID 11259213) has the molecular formula C22H15F2N3O3S and a molecular weight of 439.44 g/mol. Its IUPAC name is N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]carbamothioyl]furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]carbamothioyl]furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11259213 |
| Molecular Formula | C22H15F2N3O3S |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-[[3-[(3,4-difluorophenyl)methoxy]phenyl]carbamothioyl]furo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCc2ccc(F)c(F)c2)c1)c1cc2cnccc2o1 |
| InChI | InChI=1S/C22H15F2N3O3S/c23-17-5-4-13(8-18(17)24)12-29-16-3-1-2-15(10-16)26-22(31)27-21(28)20-9-14-11-25-7-6-19(14)30-20/h1-11H,12H2,(H2,26,27,28,31) |
| InChIKey | BSBFNOOVSZSLNI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|