C27H44N3O8P — CID 87455666
butyl 4-[(2S)-3-(4-diethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]piperazine-1-carboxylate (PubChem CID 87455666) has the molecular formula C27H44N3O8P and a molecular weight of 569.64 g/mol. Its IUPAC name is butyl 4-[(2S)-3-(4-diethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[(2S)-3-(4-diethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87455666 |
| Molecular Formula | C27H44N3O8P |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | butyl 4-[(2S)-3-(4-diethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](Cc2ccc(P(=O)(OCC)OCC)cc2)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H44N3O8P/c1-7-10-19-35-26(33)30-17-15-29(16-18-30)24(31)23(28-25(32)38-27(4,5)6)20-21-11-13-22(14-12-21)39(34,36-8-2)37-9-3/h11-14,23H,7-10,15-20H2,1-6H3,(H,28,32)/t23-/m0/s1 |
| InChIKey | QWNWPSZBWWCXEZ-QHCPKHFHSA-N |
| XLogP | 4.09 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|