C22H36N3O6P — CID 141396309
butyl 3-[(2S)-2-amino-3-(4-diethoxyphosphorylphenyl)propanoyl]piperazine-1-carboxylate (PubChem CID 141396309) has the molecular formula C22H36N3O6P and a molecular weight of 469.52 g/mol. Its IUPAC name is butyl 3-[(2S)-2-amino-3-(4-diethoxyphosphorylphenyl)propanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 3-[(2S)-2-amino-3-(4-diethoxyphosphorylphenyl)propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141396309 |
| Molecular Formula | C22H36N3O6P |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | butyl 3-[(2S)-2-amino-3-(4-diethoxyphosphorylphenyl)propanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCNC(C(=O)[C@@H](N)Cc2ccc(P(=O)(OCC)OCC)cc2)C1 |
| InChI | InChI=1S/C22H36N3O6P/c1-4-7-14-29-22(27)25-13-12-24-20(16-25)21(26)19(23)15-17-8-10-18(11-9-17)32(28,30-5-2)31-6-3/h8-11,19-20,24H,4-7,12-16,23H2,1-3H3/t19-,20?/m0/s1 |
| InChIKey | PCAJNBGSHVHWLW-XJDOXCRVSA-N |
| XLogP | 2.23 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|