C29H25FN2O2 — CID 87455944
3-ethynyl-N-[[(2S,5S)-3-[2-(3-fluorophenyl)-4-methylbenzoyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]benzamide (PubChem CID 87455944) has the molecular formula C29H25FN2O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 3-ethynyl-N-[[(2S,5S)-3-[2-(3-fluorophenyl)-4-methylbenzoyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]benzamide.
| Compound Name | 3-ethynyl-N-[[(2S,5S)-3-[2-(3-fluorophenyl)-4-methylbenzoyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 87455944 |
| Molecular Formula | C29H25FN2O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3-ethynyl-N-[[(2S,5S)-3-[2-(3-fluorophenyl)-4-methylbenzoyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]benzamide |
| SMILES | C#Cc1cccc(C(=O)NC[C@@H]2C3C[C@@H]3CN2C(=O)c2ccc(C)cc2-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C29H25FN2O2/c1-3-19-6-4-8-21(13-19)28(33)31-16-27-26-15-22(26)17-32(27)29(34)24-11-10-18(2)12-25(24)20-7-5-9-23(30)14-20/h1,4-14,22,26-27H,15-17H2,2H3,(H,31,33)/t22-,26?,27-/m1/s1 |
| InChIKey | AWRHFNFFSYFWRM-JUOSERRJSA-N |
| XLogP | 4.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|