About 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine
4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine (PubChem CID 87456100) has the molecular formula C23H12F2N6O4
and a molecular weight of 474.38 g/mol. Its IUPAC name is 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 87456100 |
| Molecular Formula | C23H12F2N6O4 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine |
| SMILES | O=[N+]([O-])c1cc(-c2nc3[nH]ncc3c(-c3ccc(F)c([N+](=O)[O-])c3)c2-c2ccncc2)ccc1F |
| InChI | InChI=1S/C23H12F2N6O4/c24-16-3-1-13(9-18(16)30(32)33)20-15-11-27-29-23(15)28-22(21(20)12-5-7-26-8-6-12)14-2-4-17(25)19(10-14)31(34)35/h1-11H,(H,27,28,29) |
| InChIKey | KUQBICCGTXKBIG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine (CID 87456100) is 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine is O=[N+]([O-])c1cc(-c2nc3[nH]ncc3c(-c3ccc(F)c([N+](=O)[O-])c3)c2-c2ccncc2)ccc1F.
What is the InChIKey of 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
The InChIKey is KUQBICCGTXKBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H12F2N6O4/c24-16-3-1-13(9-18(16)30(32)33)20-15-11-27-29-23(15)28-22(21(20)12-5-7-26-8-6-12)14-2-4-17(25)19(10-14)31(34)35/h1-11H,(H,27,28,29).
What are the key properties of 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine has a molecular weight of 474.38 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(4-fluoro-3-nitrophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 87456100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).