C28H32AsClN5O2 — CID 87457909
CID 87457909 (PubChem CID 87457909) has the molecular formula C28H32AsClN5O2 and a molecular weight of 580.97 g/mol.
| Compound Name | CID 87457909 |
|---|---|
| PubChem CID | 87457909 |
| Molecular Formula | C28H32AsClN5O2 |
| Molecular Weight | 580.97 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | — |
| SMILES | NC(=O)c1ccccc1CC[As]c1nc(Nc2ccc3c(c2)CCC(N2CCOCC2)CC3)ncc1Cl |
| InChI | InChI=1S/C28H32AsClN5O2/c30-25-18-32-28(34-26(25)29-12-11-20-3-1-2-4-24(20)27(31)36)33-22-8-5-19-6-9-23(10-7-21(19)17-22)35-13-15-37-16-14-35/h1-5,8,17-18,23H,6-7,9-16H2,(H2,31,36)(H,32,33,34) |
| InChIKey | GCJJKKGSBLVVMW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.97 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|