C14H17NO3S — CID 87460530
(4R)-3-oxo-4-(3-phenylpropanoylamino)pentanethioic S-acid (PubChem CID 87460530) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is (4R)-3-oxo-4-(3-phenylpropanoylamino)pentanethioic S-acid.
| Compound Name | (4R)-3-oxo-4-(3-phenylpropanoylamino)pentanethioic S-acid |
|---|---|
| PubChem CID | 87460530 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (4R)-3-oxo-4-(3-phenylpropanoylamino)pentanethioic S-acid |
| SMILES | C[C@@H](NC(=O)CCc1ccccc1)C(=O)CC(=O)S |
| InChI | InChI=1S/C14H17NO3S/c1-10(12(16)9-14(18)19)15-13(17)8-7-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | MPYJAQQMUVVRKN-SNVBAGLBSA-N |
| XLogP | 1.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|