C21H32FN3O2 — CID 87461798
N-[4-(dimethylamino)-4-[(2-fluorophenyl)methyl]cyclohexyl]-2-(propan-2-ylideneamino)oxypropanamide (PubChem CID 87461798) has the molecular formula C21H32FN3O2 and a molecular weight of 377.50 g/mol. Its IUPAC name is N-[4-(dimethylamino)-4-[(2-fluorophenyl)methyl]cyclohexyl]-2-(propan-2-ylideneamino)oxypropanamide.
| Compound Name | N-[4-(dimethylamino)-4-[(2-fluorophenyl)methyl]cyclohexyl]-2-(propan-2-ylideneamino)oxypropanamide |
|---|---|
| PubChem CID | 87461798 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-[4-(dimethylamino)-4-[(2-fluorophenyl)methyl]cyclohexyl]-2-(propan-2-ylideneamino)oxypropanamide |
| SMILES | CC(C)=NOC(C)C(=O)NC1CCC(Cc2ccccc2F)(N(C)C)CC1 |
| InChI | InChI=1S/C21H32FN3O2/c1-15(2)24-27-16(3)20(26)23-18-10-12-21(13-11-18,25(4)5)14-17-8-6-7-9-19(17)22/h6-9,16,18H,10-14H2,1-5H3,(H,23,26) |
| InChIKey | MWPQVELUFJYKOE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|