C17H15FN2O3 — CID 87463729
[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino] 1-methylcyclopropane-1-carboxylate (PubChem CID 87463729) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is [[6-(3-fluorophenyl)pyridine-3-carbonyl]amino] 1-methylcyclopropane-1-carboxylate.
| Compound Name | [[6-(3-fluorophenyl)pyridine-3-carbonyl]amino] 1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 87463729 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [[6-(3-fluorophenyl)pyridine-3-carbonyl]amino] 1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)ONC(=O)c2ccc(-c3cccc(F)c3)nc2)CC1 |
| InChI | InChI=1S/C17H15FN2O3/c1-17(7-8-17)16(22)23-20-15(21)12-5-6-14(19-10-12)11-3-2-4-13(18)9-11/h2-6,9-10H,7-8H2,1H3,(H,20,21) |
| InChIKey | DXIBXHUZJWZTNX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|