C6H12N2O3S — CID 87464183
2,3-dimethyl-1H-imidazol-3-ium;methanesulfonate (PubChem CID 87464183) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2,3-dimethyl-1H-imidazol-3-ium;methanesulfonate.
| Compound Name | 2,3-dimethyl-1H-imidazol-3-ium;methanesulfonate |
|---|---|
| PubChem CID | 87464183 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2,3-dimethyl-1H-imidazol-3-ium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].Cc1[nH]cc[n+]1C |
| InChI | InChI=1S/C5H8N2.CH4O3S/c1-5-6-3-4-7(5)2;1-5(2,3)4/h3-4H,1-2H3;1H3,(H,2,3,4) |
| InChIKey | KBDQWGZAVQFVBO-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|