C22H20N2O4 — CID 87467946
3-(4-carbamoylphenyl)-N-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 87467946) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-(4-carbamoylphenyl)-N-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 3-(4-carbamoylphenyl)-N-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 87467946 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-(4-carbamoylphenyl)-N-hydroxy-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CN(O)C(=O)c2cccc(-c3ccc(C(N)=O)cc3)c2)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-28-20-11-5-15(6-12-20)14-24(27)22(26)19-4-2-3-18(13-19)16-7-9-17(10-8-16)21(23)25/h2-13,27H,14H2,1H3,(H2,23,25) |
| InChIKey | QQJQIKNYRPFBPU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|