C35H34N4O5 — CID 87471003
3-carbamoyl-4-(2,4-dioxo-1,3-diazetidine-1-carboximidoyl)-5,6-dipentylperylene-2-carboxylic acid (PubChem CID 87471003) has the molecular formula C35H34N4O5 and a molecular weight of 590.68 g/mol. Its IUPAC name is 3-carbamoyl-4-(2,4-dioxo-1,3-diazetidine-1-carboximidoyl)-5,6-dipentylperylene-2-carboxylic acid.
| Compound Name | 3-carbamoyl-4-(2,4-dioxo-1,3-diazetidine-1-carboximidoyl)-5,6-dipentylperylene-2-carboxylic acid |
|---|---|
| PubChem CID | 87471003 |
| Molecular Formula | C35H34N4O5 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 3-carbamoyl-4-(2,4-dioxo-1,3-diazetidine-1-carboximidoyl)-5,6-dipentylperylene-2-carboxylic acid |
| SMILES | [H]/N=C(/c1c(CCCCC)c(CCCCC)c2c3cccc4cccc(c5cc(C(=O)O)c(C(N)=O)c1c52)c43)N1C(=O)NC1=O |
| InChI | InChI=1S/C35H34N4O5/c1-3-5-7-13-19-20(14-8-6-4-2)28(31(36)39-34(43)38-35(39)44)30-27-23(17-24(33(41)42)29(30)32(37)40)21-15-9-11-18-12-10-16-22(25(18)21)26(19)27/h9-12,15-17,36H,3-8,13-14H2,1-2H3,(H2,37,40)(H,41,42)(H,38,43,44)/b36-31- |
| InChIKey | PLERAQXAUQLKRE-WWIWEHRJSA-N |
| XLogP | 7.47 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|