C11H11Br2ClN2O3 — CID 87475387
5-(1-bromoethenyl)-1-[(2R,5S)-5-(bromomethyl)-4-chlorooxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 87475387) has the molecular formula C11H11Br2ClN2O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is 5-(1-bromoethenyl)-1-[(2R,5S)-5-(bromomethyl)-4-chlorooxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(1-bromoethenyl)-1-[(2R,5S)-5-(bromomethyl)-4-chlorooxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87475387 |
| Molecular Formula | C11H11Br2ClN2O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 411.88 |
| IUPAC Name | 5-(1-bromoethenyl)-1-[(2R,5S)-5-(bromomethyl)-4-chlorooxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C(Br)c1cn([C@H]2CC(Cl)[C@@H](CBr)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H11Br2ClN2O3/c1-5(13)6-4-16(11(18)15-10(6)17)9-2-7(14)8(3-12)19-9/h4,7-9H,1-3H2,(H,15,17,18)/t7?,8-,9-/m1/s1 |
| InChIKey | FPAXZGMPFHCPJJ-CFCGPWAMSA-N |
| XLogP | 2.19 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|