C11H11BrClN5O3 — CID 118413056
1-[(2R,5R)-5-(azidomethyl)-4-chlorooxolan-2-yl]-5-(1-bromoethenyl)pyrimidine-2,4-dione (PubChem CID 118413056) has the molecular formula C11H11BrClN5O3 and a molecular weight of 376.60 g/mol. Its IUPAC name is 1-[(2R,5R)-5-(azidomethyl)-4-chlorooxolan-2-yl]-5-(1-bromoethenyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-(azidomethyl)-4-chlorooxolan-2-yl]-5-(1-bromoethenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118413056 |
| Molecular Formula | C11H11BrClN5O3 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 1-[(2R,5R)-5-(azidomethyl)-4-chlorooxolan-2-yl]-5-(1-bromoethenyl)pyrimidine-2,4-dione |
| SMILES | C=C(Br)c1cn([C@H]2CC(Cl)[C@@H](CN=[N+]=[N-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H11BrClN5O3/c1-5(12)6-4-18(11(20)16-10(6)19)9-2-7(13)8(21-9)3-15-17-14/h4,7-9H,1-3H2,(H,16,19,20)/t7?,8-,9-/m1/s1 |
| InChIKey | QWXVAXZFNHKOPI-CFCGPWAMSA-N |
| XLogP | 2.11 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|