About S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate
S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate (PubChem CID 87477983) has the molecular formula C6H10O2S6
and a molecular weight of 306.55 g/mol. Its IUPAC name is S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate.
Molecular Properties
| Compound Name | S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate |
| PubChem CID | 87477983 |
| Molecular Formula | C6H10O2S6 |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate |
| SMILES | O=C(CC(S)S)SSC(=O)CC(S)S |
| InChI | InChI=1S/C6H10O2S6/c7-3(1-5(9)10)13-14-4(8)2-6(11)12/h5-6,9-12H,1-2H2 |
| InChIKey | ZSHMGOUPAJNEJC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate?
The IUPAC name of S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate (CID 87477983) is S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate.
What is the SMILES notation for S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate?
The canonical SMILES for S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate is O=C(CC(S)S)SSC(=O)CC(S)S.
What is the InChIKey of S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate?
The InChIKey is ZSHMGOUPAJNEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S6/c7-3(1-5(9)10)13-14-4(8)2-6(11)12/h5-6,9-12H,1-2H2.
What are the key properties of S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate?
S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate has a molecular weight of 306.55 g/mol, XLogP of 2.57, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3,3-bis(sulfanyl)propanoylsulfanyl] 3,3-bis(sulfanyl)propanethioate is sourced from PubChem (CID 87477983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).