About [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate
[1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate (PubChem CID 87479731) has the molecular formula C18H32O4S2
and a molecular weight of 376.58 g/mol. Its IUPAC name is [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate.
Molecular Properties
| Compound Name | [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate |
| PubChem CID | 87479731 |
| Molecular Formula | C18H32O4S2 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate |
| SMILES | CC(S)CCC(=O)OCC1(COC(=O)CCC(C)S)CCCCC1 |
| InChI | InChI=1S/C18H32O4S2/c1-14(23)6-8-16(19)21-12-18(10-4-3-5-11-18)13-22-17(20)9-7-15(2)24/h14-15,23-24H,3-13H2,1-2H3 |
| InChIKey | AMVMJNNCHPPXFF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate?
The IUPAC name of [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate (CID 87479731) is [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate.
What is the SMILES notation for [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate?
The canonical SMILES for [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate is CC(S)CCC(=O)OCC1(COC(=O)CCC(C)S)CCCCC1.
What is the InChIKey of [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate?
The InChIKey is AMVMJNNCHPPXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O4S2/c1-14(23)6-8-16(19)21-12-18(10-4-3-5-11-18)13-22-17(20)9-7-15(2)24/h14-15,23-24H,3-13H2,1-2H3.
What are the key properties of [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate?
[1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate has a molecular weight of 376.58 g/mol, XLogP of 4.22, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-sulfanylpentanoyloxymethyl)cyclohexyl]methyl 4-sulfanylpentanoate is sourced from PubChem (CID 87479731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).