C12H17NO5 — CID 87481183
(2-methylpropan-2-yl)oxycarbonyl 4-ethynyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 87481183) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 4-ethynyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 4-ethynyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87481183 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 4-ethynyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | C#CC1(O)CNC(C(=O)OC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H17NO5/c1-5-12(16)6-8(13-7-12)9(14)17-10(15)18-11(2,3)4/h1,8,13,16H,6-7H2,2-4H3 |
| InChIKey | SSLXLZKPPKACMQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|