C7H10F3NO3 — CID 68686544
methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-2-carboxylate (PubChem CID 68686544) has the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. Its IUPAC name is methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 68686544 |
| Molecular Formula | C7H10F3NO3 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(O)(C(F)(F)F)CN1 |
| InChI | InChI=1S/C7H10F3NO3/c1-14-5(12)4-2-6(13,3-11-4)7(8,9)10/h4,11,13H,2-3H2,1H3/t4-,6?/m0/s1 |
| InChIKey | ZRQGXCNWQSEMBG-VKZKZBKNSA-N |
| XLogP | -0.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |