C17H22N2O4S — CID 87483734
8-(hydroxyamino)-8-oxooctanoic acid;2-phenyl-1,3-thiazole (PubChem CID 87483734) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 8-(hydroxyamino)-8-oxooctanoic acid;2-phenyl-1,3-thiazole.
| Compound Name | 8-(hydroxyamino)-8-oxooctanoic acid;2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 87483734 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 8-(hydroxyamino)-8-oxooctanoic acid;2-phenyl-1,3-thiazole |
| SMILES | O=C(O)CCCCCCC(=O)NO.c1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C9H7NS.C8H15NO4/c1-2-4-8(5-3-1)9-10-6-7-11-9;10-7(9-13)5-3-1-2-4-6-8(11)12/h1-7H;13H,1-6H2,(H,9,10)(H,11,12) |
| InChIKey | XWKNBYIBLLQJOR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|