C23H25OS+ — CID 87491593
[4-methyl-2-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium (PubChem CID 87491593) has the molecular formula C23H25OS+ and a molecular weight of 349.52 g/mol. Its IUPAC name is [4-methyl-2-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-methyl-2-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 87491593 |
| Molecular Formula | C23H25OS+ |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | [4-methyl-2-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccccc2)c(OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H25OS/c1-18-15-16-22(21(17-18)24-23(2,3)4)25(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-17H,1-4H3/q+1 |
| InChIKey | ZAJWMFRZOLUWEL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|