C21H31N3 — CID 87492241
4-[2-[(dimethylamino)methyl]cyclopenta-1,3-dien-1-yl]-3-(2,2-dimethylpropanimidoyl)-N,N-dimethylaniline (PubChem CID 87492241) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is 4-[2-[(dimethylamino)methyl]cyclopenta-1,3-dien-1-yl]-3-(2,2-dimethylpropanimidoyl)-N,N-dimethylaniline.
| Compound Name | 4-[2-[(dimethylamino)methyl]cyclopenta-1,3-dien-1-yl]-3-(2,2-dimethylpropanimidoyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 87492241 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 4-[2-[(dimethylamino)methyl]cyclopenta-1,3-dien-1-yl]-3-(2,2-dimethylpropanimidoyl)-N,N-dimethylaniline |
| SMILES | [H]/N=C(/c1cc(N(C)C)ccc1C1=C(CN(C)C)C=CC1)C(C)(C)C |
| InChI | InChI=1S/C21H31N3/c1-21(2,3)20(22)19-13-16(24(6)7)11-12-18(19)17-10-8-9-15(17)14-23(4)5/h8-9,11-13,22H,10,14H2,1-7H3/b22-20- |
| InChIKey | SHBUCHQFOAWNNU-XDOYNYLZSA-N |
| XLogP | 4.44 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|