C5H5F3O — CID 87494793
3,5,5-trifluoropent-4-en-2-one (PubChem CID 87494793) has the molecular formula C5H5F3O and a molecular weight of 138.09 g/mol. Its IUPAC name is 3,5,5-trifluoropent-4-en-2-one.
| Compound Name | 3,5,5-trifluoropent-4-en-2-one |
|---|---|
| PubChem CID | 87494793 |
| Molecular Formula | C5H5F3O |
| Molecular Weight | 138.09 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 3,5,5-trifluoropent-4-en-2-one |
| SMILES | CC(=O)C(F)C=C(F)F |
| InChI | InChI=1S/C5H5F3O/c1-3(9)4(6)2-5(7)8/h2,4H,1H3 |
| InChIKey | FXLCOMBZRHDQHH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.09 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |