C21H23N3O4 — CID 87497708
(3-methylphenyl)methyl N-(3-hydroxypropoxy)-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate (PubChem CID 87497708) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (3-methylphenyl)methyl N-(3-hydroxypropoxy)-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate.
| Compound Name | (3-methylphenyl)methyl N-(3-hydroxypropoxy)-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 87497708 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (3-methylphenyl)methyl N-(3-hydroxypropoxy)-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate |
| SMILES | Cc1cccc(COC(=O)N(OCCCO)c2ccc(-c3cn[nH]c3)cc2)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-16-4-2-5-17(12-16)15-27-21(26)24(28-11-3-10-25)20-8-6-18(7-9-20)19-13-22-23-14-19/h2,4-9,12-14,25H,3,10-11,15H2,1H3,(H,22,23) |
| InChIKey | NIPUGXXHSWWQCZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|