C19H34O9 — CID 87499145
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-[1-(2-hydroxydecoxy)propan-2-ylperoxy]-2H-furan-5-one (PubChem CID 87499145) has the molecular formula C19H34O9 and a molecular weight of 406.47 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-[1-(2-hydroxydecoxy)propan-2-ylperoxy]-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-[1-(2-hydroxydecoxy)propan-2-ylperoxy]-2H-furan-5-one |
|---|---|
| PubChem CID | 87499145 |
| Molecular Formula | C19H34O9 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-[1-(2-hydroxydecoxy)propan-2-ylperoxy]-2H-furan-5-one |
| SMILES | CCCCCCCCC(O)COCC(C)OOC1=C(O)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C19H34O9/c1-3-4-5-6-7-8-9-14(21)12-25-11-13(2)27-28-18-16(23)19(24)26-17(18)15(22)10-20/h13-15,17,20-23H,3-12H2,1-2H3/t13?,14?,15-,17+/m0/s1 |
| InChIKey | WBRSDZKIGWVQAL-UMPYDWHISA-N |
| XLogP | 1.50 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|