C16H26N2O7S — CID 87499570
methyl (2S)-3-amino-2-(2-methylpropoxycarbonylamino)propanoate;4-methylbenzenesulfonic acid (PubChem CID 87499570) has the molecular formula C16H26N2O7S and a molecular weight of 390.46 g/mol. Its IUPAC name is methyl (2S)-3-amino-2-(2-methylpropoxycarbonylamino)propanoate;4-methylbenzenesulfonic acid.
| Compound Name | methyl (2S)-3-amino-2-(2-methylpropoxycarbonylamino)propanoate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87499570 |
| Molecular Formula | C16H26N2O7S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | methyl (2S)-3-amino-2-(2-methylpropoxycarbonylamino)propanoate;4-methylbenzenesulfonic acid |
| SMILES | COC(=O)[C@H](CN)NC(=O)OCC(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H18N2O4.C7H8O3S/c1-6(2)5-15-9(13)11-7(4-10)8(12)14-3;1-6-2-4-7(5-3-6)11(8,9)10/h6-7H,4-5,10H2,1-3H3,(H,11,13);2-5H,1H3,(H,8,9,10)/t7-;/m0./s1 |
| InChIKey | SITJPWYXIIKXKB-FJXQXJEOSA-N |
| XLogP | 1.11 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|