C19H27BrO8S — CID 91315045
dimethyl 4-acetyl-2-bromo-6-methylheptanedioate;4-methylbenzenesulfonic acid (PubChem CID 91315045) has the molecular formula C19H27BrO8S and a molecular weight of 495.39 g/mol. Its IUPAC name is dimethyl 4-acetyl-2-bromo-6-methylheptanedioate;4-methylbenzenesulfonic acid.
| Compound Name | dimethyl 4-acetyl-2-bromo-6-methylheptanedioate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 91315045 |
| Molecular Formula | C19H27BrO8S |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | dimethyl 4-acetyl-2-bromo-6-methylheptanedioate;4-methylbenzenesulfonic acid |
| SMILES | COC(=O)C(C)CC(CC(Br)C(=O)OC)C(C)=O.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H19BrO5.C7H8O3S/c1-7(11(15)17-3)5-9(8(2)14)6-10(13)12(16)18-4;1-6-2-4-7(5-3-6)11(8,9)10/h7,9-10H,5-6H2,1-4H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | SDCMCDREXGULGX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|