5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid

C14H26O6 — CID 87499858

IUPAC5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid
SMILESCCOC(C)(C(CCC(=O)O)OC)C(C)(C)C(=O)OC
InChIInChI=1S/C14H26O6/c1-7-20-14(4,13(2,3)12(17)19-6)10(18-5)8-9-11(15)16/h10H,7-9H2,1-6H3,(H,15,16)
InChIKeyLBCWOZXYVFBAGJ-UHFFFAOYSA-N
MW290.36 g/mol
LogP1.86
Rot. Bonds9

About 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid

5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid (PubChem CID 87499858) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid.

Molecular Properties

Compound Name5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid
PubChem CID87499858
Molecular FormulaC14H26O6
Molecular Weight290.36 g/mol
Exact Mass290.17
IUPAC Name5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid
SMILESCCOC(C)(C(CCC(=O)O)OC)C(C)(C)C(=O)OC
InChIInChI=1S/C14H26O6/c1-7-20-14(4,13(2,3)12(17)19-6)10(18-5)8-9-11(15)16/h10H,7-9H2,1-6H3,(H,15,16)
InChIKeyLBCWOZXYVFBAGJ-UHFFFAOYSA-N
XLogP1.86
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.36
LogP ≤ 51.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid?
The IUPAC name of 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid (CID 87499858) is 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid.
What is the SMILES notation for 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid?
The canonical SMILES for 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid is CCOC(C)(C(CCC(=O)O)OC)C(C)(C)C(=O)OC.
What is the InChIKey of 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid?
The InChIKey is LBCWOZXYVFBAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O6/c1-7-20-14(4,13(2,3)12(17)19-6)10(18-5)8-9-11(15)16/h10H,7-9H2,1-6H3,(H,15,16).
What are the key properties of 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid?
5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid has a molecular weight of 290.36 g/mol, XLogP of 1.86, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid is sourced from PubChem (CID 87499858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).