C14H26O6 — CID 87499858
5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid (PubChem CID 87499858) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid.
| Compound Name | 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 87499858 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 5-ethoxy-4,7-dimethoxy-5,6,6-trimethyl-7-oxoheptanoic acid |
| SMILES | CCOC(C)(C(CCC(=O)O)OC)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C14H26O6/c1-7-20-14(4,13(2,3)12(17)19-6)10(18-5)8-9-11(15)16/h10H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | LBCWOZXYVFBAGJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |