C24H53N2O5P — CID 87501824
[7-amino-2-butoxy-4-[(trimethylazaniumyl)methyl]hexadecan-4-yl] hydrogen phosphate (PubChem CID 87501824) has the molecular formula C24H53N2O5P and a molecular weight of 480.67 g/mol. Its IUPAC name is [7-amino-2-butoxy-4-[(trimethylazaniumyl)methyl]hexadecan-4-yl] hydrogen phosphate.
| Compound Name | [7-amino-2-butoxy-4-[(trimethylazaniumyl)methyl]hexadecan-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 87501824 |
| Molecular Formula | C24H53N2O5P |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | [7-amino-2-butoxy-4-[(trimethylazaniumyl)methyl]hexadecan-4-yl] hydrogen phosphate |
| SMILES | CCCCCCCCCC(N)CCC(CC(C)OCCCC)(C[N+](C)(C)C)OP(=O)([O-])O |
| InChI | InChI=1S/C24H53N2O5P/c1-7-9-11-12-13-14-15-16-23(25)17-18-24(21-26(4,5)6,31-32(27,28)29)20-22(3)30-19-10-8-2/h22-23H,7-21,25H2,1-6H3,(H-,27,28,29) |
| InChIKey | YYCMTWMAULGAMF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|