C46H90N4O7 — CID 87502527
2-(2-amino-2-oxoethoxy)-N-[3-[3-[[2-[2-(dioctylamino)-2-oxoethoxy]acetyl]amino]propoxy]propyl]-N-octyldecanamide (PubChem CID 87502527) has the molecular formula C46H90N4O7 and a molecular weight of 811.25 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)-N-[3-[3-[[2-[2-(dioctylamino)-2-oxoethoxy]acetyl]amino]propoxy]propyl]-N-octyldecanamide.
| Compound Name | 2-(2-amino-2-oxoethoxy)-N-[3-[3-[[2-[2-(dioctylamino)-2-oxoethoxy]acetyl]amino]propoxy]propyl]-N-octyldecanamide |
|---|---|
| PubChem CID | 87502527 |
| Molecular Formula | C46H90N4O7 |
| Molecular Weight | 811.25 g/mol |
| Exact Mass | 810.68 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)-N-[3-[3-[[2-[2-(dioctylamino)-2-oxoethoxy]acetyl]amino]propoxy]propyl]-N-octyldecanamide |
| SMILES | CCCCCCCCC(OCC(N)=O)C(=O)N(CCCCCCCC)CCCOCCCNC(=O)COCC(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C46H90N4O7/c1-5-9-13-17-21-25-31-42(57-39-43(47)51)46(54)50(35-28-24-20-16-12-8-4)36-30-38-55-37-29-32-48-44(52)40-56-41-45(53)49(33-26-22-18-14-10-6-2)34-27-23-19-15-11-7-3/h42H,5-41H2,1-4H3,(H2,47,51)(H,48,52) |
| InChIKey | LFOFIFXXYDCYAI-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.25 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|