About N-ethyl-N'-hexylprop-2-enehydrazide
N-ethyl-N'-hexylprop-2-enehydrazide (PubChem CID 87503833) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is N-ethyl-N'-hexylprop-2-enehydrazide.
Molecular Properties
| Compound Name | N-ethyl-N'-hexylprop-2-enehydrazide |
| PubChem CID | 87503833 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-ethyl-N'-hexylprop-2-enehydrazide |
| SMILES | C=CC(=O)N(CC)NCCCCCC |
| InChI | InChI=1S/C11H22N2O/c1-4-7-8-9-10-12-13(6-3)11(14)5-2/h5,12H,2,4,6-10H2,1,3H3 |
| InChIKey | OIPMIFJNIWYYSR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-hexylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-hexylprop-2-enehydrazide?
The IUPAC name of N-ethyl-N'-hexylprop-2-enehydrazide (CID 87503833) is N-ethyl-N'-hexylprop-2-enehydrazide.
What is the SMILES notation for N-ethyl-N'-hexylprop-2-enehydrazide?
The canonical SMILES for N-ethyl-N'-hexylprop-2-enehydrazide is C=CC(=O)N(CC)NCCCCCC.
What is the InChIKey of N-ethyl-N'-hexylprop-2-enehydrazide?
The InChIKey is OIPMIFJNIWYYSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-4-7-8-9-10-12-13(6-3)11(14)5-2/h5,12H,2,4,6-10H2,1,3H3.
What are the key properties of N-ethyl-N'-hexylprop-2-enehydrazide?
N-ethyl-N'-hexylprop-2-enehydrazide has a molecular weight of 198.31 g/mol, XLogP of 2.11, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-hexylprop-2-enehydrazide is sourced from PubChem (CID 87503833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).