C15H26O8 — CID 87504133
tripropan-2-yl 2-hydroperoxypropane-1,2,3-tricarboxylate (PubChem CID 87504133) has the molecular formula C15H26O8 and a molecular weight of 334.37 g/mol. Its IUPAC name is tripropan-2-yl 2-hydroperoxypropane-1,2,3-tricarboxylate.
| Compound Name | tripropan-2-yl 2-hydroperoxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87504133 |
| Molecular Formula | C15H26O8 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | tripropan-2-yl 2-hydroperoxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)OC(=O)CC(CC(=O)OC(C)C)(OO)C(=O)OC(C)C |
| InChI | InChI=1S/C15H26O8/c1-9(2)20-12(16)7-15(23-19,14(18)22-11(5)6)8-13(17)21-10(3)4/h9-11,19H,7-8H2,1-6H3 |
| InChIKey | QDTDFJAETCYNIN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|