About 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium
3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium (PubChem CID 87504446) has the molecular formula C20H28O6P2+2
and a molecular weight of 426.39 g/mol. Its IUPAC name is 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium.
Molecular Properties
| Compound Name | 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
| PubChem CID | 87504446 |
| Molecular Formula | C20H28O6P2+2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
| SMILES | CCCCc1ccc(O)c(-c2ccccc2)c1CCCC.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C20H26O.O5P2/c1-3-5-10-16-14-15-19(21)20(18(16)13-6-4-2)17-11-8-7-9-12-17;1-6(2)5-7(3)4/h7-9,11-12,14-15,21H,3-6,10,13H2,1-2H3;/p+2 |
| InChIKey | IPJNPEQMQURNSQ-UHFFFAOYSA-P |
| XLogP | 6.05 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
The IUPAC name of 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium (CID 87504446) is 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium.
What is the SMILES notation for 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
The canonical SMILES for 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium is CCCCc1ccc(O)c(-c2ccccc2)c1CCCC.O=[P+](O)O[P+](=O)O.
What is the InChIKey of 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
The InChIKey is IPJNPEQMQURNSQ-UHFFFAOYSA-P. The full InChI is InChI=1S/C20H26O.O5P2/c1-3-5-10-16-14-15-19(21)20(18(16)13-6-4-2)17-11-8-7-9-12-17;1-6(2)5-7(3)4/h7-9,11-12,14-15,21H,3-6,10,13H2,1-2H3;/p+2.
What are the key properties of 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium?
3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium has a molecular weight of 426.39 g/mol, XLogP of 6.05, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium is sourced from PubChem (CID 87504446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).