C20H28O6P2+2 — CID 87504446
3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium (PubChem CID 87504446) has the molecular formula C20H28O6P2+2 and a molecular weight of 426.39 g/mol. Its IUPAC name is 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium.
| Compound Name | 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 87504446 |
| Molecular Formula | C20H28O6P2+2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3,4-dibutyl-2-phenylphenol;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
| SMILES | CCCCc1ccc(O)c(-c2ccccc2)c1CCCC.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C20H26O.O5P2/c1-3-5-10-16-14-15-19(21)20(18(16)13-6-4-2)17-11-8-7-9-12-17;1-6(2)5-7(3)4/h7-9,11-12,14-15,21H,3-6,10,13H2,1-2H3;/p+2 |
| InChIKey | IPJNPEQMQURNSQ-UHFFFAOYSA-P |
| XLogP | 6.05 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|