C22H18N6O — CID 87507471
5-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)-2-(propan-2-ylideneamino)oxybenzonitrile (PubChem CID 87507471) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is 5-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)-2-(propan-2-ylideneamino)oxybenzonitrile.
| Compound Name | 5-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)-2-(propan-2-ylideneamino)oxybenzonitrile |
|---|---|
| PubChem CID | 87507471 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-5-yl)-2-(propan-2-ylideneamino)oxybenzonitrile |
| SMILES | CC(C)=NOc1ccc(-c2cccc3nc(Nc4ccccc4)nn23)cc1C#N |
| InChI | InChI=1S/C22H18N6O/c1-15(2)27-29-20-12-11-16(13-17(20)14-23)19-9-6-10-21-25-22(26-28(19)21)24-18-7-4-3-5-8-18/h3-13H,1-2H3,(H,24,26) |
| InChIKey | FPVNILLOJOSBGX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|