C28H29N5O4 — CID 87510232
[ethyl-[[3-[7-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]phenyl]carbamoyl]amino] formate (PubChem CID 87510232) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is [ethyl-[[3-[7-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]phenyl]carbamoyl]amino] formate.
| Compound Name | [ethyl-[[3-[7-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]phenyl]carbamoyl]amino] formate |
|---|---|
| PubChem CID | 87510232 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | [ethyl-[[3-[7-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]phenyl]carbamoyl]amino] formate |
| SMILES | CCN(OC=O)C(=O)Nc1cccc(-c2cnc3cc(-c4cccc(CN5CCOCC5)c4)ccn23)c1 |
| InChI | InChI=1S/C28H29N5O4/c1-2-33(37-20-34)28(35)30-25-8-4-7-24(16-25)26-18-29-27-17-23(9-10-32(26)27)22-6-3-5-21(15-22)19-31-11-13-36-14-12-31/h3-10,15-18,20H,2,11-14,19H2,1H3,(H,30,35) |
| InChIKey | IMBZAHJBIZHFET-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|