C20H23Cl2SiTi — CID 87514554
[2-(2-butylcyclopenta-1,3-dien-1-yl)-3H-inden-3-id-1-ylidene]-dimethylsilane;titanium(3+);dichloride (PubChem CID 87514554) has the molecular formula C20H23Cl2SiTi and a molecular weight of 410.26 g/mol. Its IUPAC name is [2-(2-butylcyclopenta-1,3-dien-1-yl)-3H-inden-3-id-1-ylidene]-dimethylsilane;titanium(3+);dichloride.
| Compound Name | [2-(2-butylcyclopenta-1,3-dien-1-yl)-3H-inden-3-id-1-ylidene]-dimethylsilane;titanium(3+);dichloride |
|---|---|
| PubChem CID | 87514554 |
| Molecular Formula | C20H23Cl2SiTi |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | [2-(2-butylcyclopenta-1,3-dien-1-yl)-3H-inden-3-id-1-ylidene]-dimethylsilane;titanium(3+);dichloride |
| SMILES | CCCCC1=C(C2=[C-]c3ccccc3C2=[Si](C)C)CC=C1.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C20H23Si.2ClH.Ti/c1-4-5-9-15-11-8-13-17(15)19-14-16-10-6-7-12-18(16)20(19)21(2)3;;;/h6-8,10-12H,4-5,9,13H2,1-3H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | BGUVXZMYTRLPPX-UHFFFAOYSA-L |
| XLogP | -0.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|