C34H40 — CID 123514923
1-[(2-butylcyclopenta-1,3-dien-1-yl)-bis(3,5-dimethylphenyl)methyl]-3,5-dimethylbenzene (PubChem CID 123514923) has the molecular formula C34H40 and a molecular weight of 448.69 g/mol. Its IUPAC name is 1-[(2-butylcyclopenta-1,3-dien-1-yl)-bis(3,5-dimethylphenyl)methyl]-3,5-dimethylbenzene.
| Compound Name | 1-[(2-butylcyclopenta-1,3-dien-1-yl)-bis(3,5-dimethylphenyl)methyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 123514923 |
| Molecular Formula | C34H40 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | 1-[(2-butylcyclopenta-1,3-dien-1-yl)-bis(3,5-dimethylphenyl)methyl]-3,5-dimethylbenzene |
| SMILES | CCCCC1=C(C(c2cc(C)cc(C)c2)(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)CC=C1 |
| InChI | InChI=1S/C34H40/c1-8-9-11-29-12-10-13-33(29)34(30-17-23(2)14-24(3)18-30,31-19-25(4)15-26(5)20-31)32-21-27(6)16-28(7)22-32/h10,12,14-22H,8-9,11,13H2,1-7H3 |
| InChIKey | YLKLLKXNZVCGRM-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|