About CID 87515829
CID 87515829 (PubChem CID 87515829) has the molecular formula C17H26O4Si2
and a molecular weight of 350.56 g/mol.
Molecular Properties
| Compound Name | CID 87515829 |
| PubChem CID | 87515829 |
| Molecular Formula | C17H26O4Si2 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | — |
| SMILES | CCc1ccc(OCCC(C)(C)C(O[Si]C)O[Si]C)c(C=O)c1 |
| InChI | InChI=1S/C17H26O4Si2/c1-6-13-7-8-15(14(11-13)12-18)19-10-9-17(2,3)16(20-22-4)21-23-5/h7-8,11-12,16H,6,9-10H2,1-5H3 |
| InChIKey | AAKFIJSJSZBEHQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 87515829 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87515829?
The IUPAC name of CID 87515829 (CID 87515829) is not available.
What is the SMILES notation for CID 87515829?
The canonical SMILES for CID 87515829 is CCc1ccc(OCCC(C)(C)C(O[Si]C)O[Si]C)c(C=O)c1.
What is the InChIKey of CID 87515829?
The InChIKey is AAKFIJSJSZBEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4Si2/c1-6-13-7-8-15(14(11-13)12-18)19-10-9-17(2,3)16(20-22-4)21-23-5/h7-8,11-12,16H,6,9-10H2,1-5H3.
What are the key properties of CID 87515829?
CID 87515829 has a molecular weight of 350.56 g/mol, XLogP of 3.55, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87515829 is sourced from PubChem (CID 87515829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).