C19H17Cl3N4O2 — CID 87516471
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[(2-methylpropan-2-yl)oxy]-1,2,4-triazole-3-carboxamide (PubChem CID 87516471) has the molecular formula C19H17Cl3N4O2 and a molecular weight of 439.73 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[(2-methylpropan-2-yl)oxy]-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[(2-methylpropan-2-yl)oxy]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 87516471 |
| Molecular Formula | C19H17Cl3N4O2 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-[(2-methylpropan-2-yl)oxy]-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)(C)ONC(=O)c1nc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C19H17Cl3N4O2/c1-19(2,3)28-25-18(27)16-23-17(11-4-6-12(20)7-5-11)26(24-16)15-9-8-13(21)10-14(15)22/h4-10H,1-3H3,(H,25,27) |
| InChIKey | JSLMARBSBFEJNP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|